C17H25F3N4S — CID 111299253
1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111299253) has the molecular formula C17H25F3N4S and a molecular weight of 374.48 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111299253 |
| Molecular Formula | C17H25F3N4S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(/NC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C17H25F3N4S/c1-21-16(22-14-8-9-24(11-14)12-17(18,19)20)23(2)10-13-4-6-15(25-3)7-5-13/h4-7,14H,8-12H2,1-3H3,(H,21,22) |
| InChIKey | IUBKMDXYQAJQTA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|