C13H26F3IN4 — CID 111158542
1-butyl-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111158542) has the molecular formula C13H26F3IN4 and a molecular weight of 422.28 g/mol. Its IUPAC name is 1-butyl-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-butyl-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111158542 |
| Molecular Formula | C13H26F3IN4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-butyl-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C13H25F3N4.HI/c1-4-5-7-19(3)12(17-2)18-11-6-8-20(9-11)10-13(14,15)16;/h11H,4-10H2,1-3H3,(H,17,18);1H |
| InChIKey | OTTWBPNKNVMIAU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|