C19H28F2N4O2 — CID 111288711
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethylguanidine (PubChem CID 111288711) has the molecular formula C19H28F2N4O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111288711 |
| Molecular Formula | C19H28F2N4O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC1CN2CCCC2CO1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H28F2N4O2/c1-22-19(23-10-17-12-25-9-3-4-15(25)13-26-17)24(2)11-14-5-7-16(8-6-14)27-18(20)21/h5-8,15,17-18H,3-4,9-13H2,1-2H3,(H,22,23) |
| InChIKey | VMJYAFHKSKELOE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|