C26H26F3N3O3 — CID 176815247
4-(difluoromethoxy)-N-[[1-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]piperidin-4-yl]methyl]-N-methylbenzamide (PubChem CID 176815247) has the molecular formula C26H26F3N3O3 and a molecular weight of 485.51 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[[1-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]piperidin-4-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[[1-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]piperidin-4-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 176815247 |
| Molecular Formula | C26H26F3N3O3 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 4-(difluoromethoxy)-N-[[1-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]piperidin-4-yl]methyl]-N-methylbenzamide |
| SMILES | CN(CC1CCN(c2ccc(-n3ccccc3=O)cc2F)CC1)C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C26H26F3N3O3/c1-30(25(34)19-5-8-21(9-6-19)35-26(28)29)17-18-11-14-31(15-12-18)23-10-7-20(16-22(23)27)32-13-3-2-4-24(32)33/h2-10,13,16,18,26H,11-12,14-15,17H2,1H3 |
| InChIKey | AKBZYZOYLZSPGL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|