C22H27FN2O2 — CID 99974557
4-[(2-fluorophenyl)methoxy]-N-methyl-N-[[(3S)-1-methylpiperidin-3-yl]methyl]benzamide (PubChem CID 99974557) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-N-methyl-N-[[(3S)-1-methylpiperidin-3-yl]methyl]benzamide.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-N-methyl-N-[[(3S)-1-methylpiperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 99974557 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-N-methyl-N-[[(3S)-1-methylpiperidin-3-yl]methyl]benzamide |
| SMILES | CN1CCC[C@H](CN(C)C(=O)c2ccc(OCc3ccccc3F)cc2)C1 |
| InChI | InChI=1S/C22H27FN2O2/c1-24-13-5-6-17(14-24)15-25(2)22(26)18-9-11-20(12-10-18)27-16-19-7-3-4-8-21(19)23/h3-4,7-12,17H,5-6,13-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | DHKVGZQTQZMXPQ-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |