C24H29FN2O3 — CID 25446804
methyl 4-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylcarbamoyl]benzoate (PubChem CID 25446804) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl 4-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 25446804 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl 4-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(C)CC2CCN(CCc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C24H29FN2O3/c1-26(23(28)20-7-9-21(10-8-20)24(29)30-2)17-18-11-14-27(15-12-18)16-13-19-5-3-4-6-22(19)25/h3-10,18H,11-17H2,1-2H3 |
| InChIKey | RTGNOMHXMPDPEQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |