C23H31FN2O2 — CID 42591152
2-[[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylamino]methyl]-4-methoxyphenol (PubChem CID 42591152) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-[[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylamino]methyl]-4-methoxyphenol.
| Compound Name | 2-[[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylamino]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 42591152 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 2-[[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl-methylamino]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CN(C)CC2CCN(CCc3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C23H31FN2O2/c1-25(17-20-15-21(28-2)7-8-23(20)27)16-18-9-12-26(13-10-18)14-11-19-5-3-4-6-22(19)24/h3-8,15,18,27H,9-14,16-17H2,1-2H3 |
| InChIKey | ZJTFQFBSNOVULI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|