C22H34FN3O — CID 25461385
N-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methyl-2-piperidin-1-ylacetamide (PubChem CID 25461385) has the molecular formula C22H34FN3O and a molecular weight of 375.53 g/mol. Its IUPAC name is N-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methyl-2-piperidin-1-ylacetamide.
| Compound Name | N-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methyl-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 25461385 |
| Molecular Formula | C22H34FN3O |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-[[1-[2-(2-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methyl-2-piperidin-1-ylacetamide |
| SMILES | CN(CC1CCN(CCc2ccccc2F)CC1)C(=O)CN1CCCCC1 |
| InChI | InChI=1S/C22H34FN3O/c1-24(22(27)18-26-12-5-2-6-13-26)17-19-9-14-25(15-10-19)16-11-20-7-3-4-8-21(20)23/h3-4,7-8,19H,2,5-6,9-18H2,1H3 |
| InChIKey | ZXXOXCZVPFHGPE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |