C20H20Cl2N2O3 — CID 108543875
[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 108543875) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 108543875 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-27-16-6-3-14(4-7-16)19(25)23-9-2-10-24(12-11-23)20(26)17-13-15(21)5-8-18(17)22/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | FOLQNAVDPPRVIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |