C14H17F2N3O — CID 66204072
[4-(azetidin-3-yl)piperazin-1-yl]-(2,5-difluorophenyl)methanone (PubChem CID 66204072) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is [4-(azetidin-3-yl)piperazin-1-yl]-(2,5-difluorophenyl)methanone.
| Compound Name | [4-(azetidin-3-yl)piperazin-1-yl]-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 66204072 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [4-(azetidin-3-yl)piperazin-1-yl]-(2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C14H17F2N3O/c15-10-1-2-13(16)12(7-10)14(20)19-5-3-18(4-6-19)11-8-17-9-11/h1-2,7,11,17H,3-6,8-9H2 |
| InChIKey | LUTZVGKWUCJGEN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |