C15H16ClF3N2O2 — CID 108566670
2-chloro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]propanamide (PubChem CID 108566670) has the molecular formula C15H16ClF3N2O2 and a molecular weight of 348.75 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108566670 |
| Molecular Formula | C15H16ClF3N2O2 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-chloro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]propanamide |
| SMILES | CC(Cl)C(=O)NC1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H16ClF3N2O2/c1-8(16)14(22)20-9-4-6-21(7-5-9)15(23)10-2-3-11(17)13(19)12(10)18/h2-3,8-9H,4-7H2,1H3,(H,20,22) |
| InChIKey | UTENQPCPRQYAQJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|