C15H17Cl2FN2O2 — CID 108567332
2-chloro-N-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]propanamide (PubChem CID 108567332) has the molecular formula C15H17Cl2FN2O2 and a molecular weight of 347.22 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108567332 |
| Molecular Formula | C15H17Cl2FN2O2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-chloro-N-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]propanamide |
| SMILES | CC(Cl)C(=O)NC1CCN(C(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H17Cl2FN2O2/c1-9(16)14(21)19-10-5-7-20(8-6-10)15(22)13-11(17)3-2-4-12(13)18/h2-4,9-10H,5-8H2,1H3,(H,19,21) |
| InChIKey | OCSWKEQDTXYZCI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|