C23H26BrN3O3 — CID 167853019
1-(3-bromo-5-pyrrolidin-1-ylbenzoyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 167853019) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is 1-(3-bromo-5-pyrrolidin-1-ylbenzoyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-bromo-5-pyrrolidin-1-ylbenzoyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167853019 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1-(3-bromo-5-pyrrolidin-1-ylbenzoyl)-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN(C(=O)c2cc(Br)cc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C23H26BrN3O3/c24-18-13-17(14-19(15-18)26-9-3-4-10-26)23(30)27-11-7-16(8-12-27)22(29)25-20-5-1-2-6-21(20)28/h1-2,5-6,13-16,28H,3-4,7-12H2,(H,25,29) |
| InChIKey | VAKAZJVEKJDBNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|