C20H21N5O3 — CID 136516099
N-(2-hydroxyphenyl)-1-(1-methylbenzotriazole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 136516099) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1-(1-methylbenzotriazole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1-(1-methylbenzotriazole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 136516099 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(2-hydroxyphenyl)-1-(1-methylbenzotriazole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | Cn1nnc2cc(C(=O)N3CCC(C(=O)Nc4ccccc4O)CC3)ccc21 |
| InChI | InChI=1S/C20H21N5O3/c1-24-17-7-6-14(12-16(17)22-23-24)20(28)25-10-8-13(9-11-25)19(27)21-15-4-2-3-5-18(15)26/h2-7,12-13,26H,8-11H2,1H3,(H,21,27) |
| InChIKey | VMPBAOFDEQDAEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|