C17H24ClN3O2 — CID 126805479
1-N-(3-chloro-2,6-diethylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 126805479) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-N-(3-chloro-2,6-diethylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-chloro-2,6-diethylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 126805479 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-N-(3-chloro-2,6-diethylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-3-11-7-8-14(18)13(4-2)15(11)20-17(23)21-9-5-6-12(10-21)16(19)22/h7-8,12H,3-6,9-10H2,1-2H3,(H2,19,22)(H,20,23) |
| InChIKey | JBSWRYWPVFTAPY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |