C16H23N5O2 — CID 95580121
(3S)-1-N-(2-piperidin-1-yl-3-pyridinyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 95580121) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3S)-1-N-(2-piperidin-1-yl-3-pyridinyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-(2-piperidin-1-yl-3-pyridinyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95580121 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (3S)-1-N-(2-piperidin-1-yl-3-pyridinyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCN(C(=O)Nc2cccnc2N2CCCCC2)C1 |
| InChI | InChI=1S/C16H23N5O2/c17-14(22)12-6-10-21(11-12)16(23)19-13-5-4-7-18-15(13)20-8-2-1-3-9-20/h4-5,7,12H,1-3,6,8-11H2,(H2,17,22)(H,19,23)/t12-/m0/s1 |
| InChIKey | AMHAPPYSZZGQKO-LBPRGKRZSA-N |
| XLogP | 1.41 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |