C20H26F3N3O2 — CID 55533928
1-N-phenyl-3-N-[2-(trifluoromethyl)cyclohexyl]piperidine-1,3-dicarboxamide (PubChem CID 55533928) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-N-phenyl-3-N-[2-(trifluoromethyl)cyclohexyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-phenyl-3-N-[2-(trifluoromethyl)cyclohexyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55533928 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-N-phenyl-3-N-[2-(trifluoromethyl)cyclohexyl]piperidine-1,3-dicarboxamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H26F3N3O2/c21-20(22,23)16-10-4-5-11-17(16)25-18(27)14-7-6-12-26(13-14)19(28)24-15-8-2-1-3-9-15/h1-3,8-9,14,16-17H,4-7,10-13H2,(H,24,28)(H,25,27) |
| InChIKey | SZESQCVVIMOOTG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |