C13H17N3O4 — CID 137147280
ethyl 1-(6-oxo-1H-pyrimidine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 137147280) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethyl 1-(6-oxo-1H-pyrimidine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(6-oxo-1H-pyrimidine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 137147280 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethyl 1-(6-oxo-1H-pyrimidine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(=O)[nH]cn2)CC1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-20-13(19)9-3-5-16(6-4-9)12(18)10-7-11(17)15-8-14-10/h7-9H,2-6H2,1H3,(H,14,15,17) |
| InChIKey | IYBPKBPFLPHDBU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |