C18H18BrClN2OS — CID 3543249
4-(4-bromophenyl)-N-(4-chlorophenyl)-4-hydroxypiperidine-1-carbothioamide (PubChem CID 3543249) has the molecular formula C18H18BrClN2OS and a molecular weight of 425.78 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(4-chlorophenyl)-4-hydroxypiperidine-1-carbothioamide.
| Compound Name | 4-(4-bromophenyl)-N-(4-chlorophenyl)-4-hydroxypiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3543249 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 4-(4-bromophenyl)-N-(4-chlorophenyl)-4-hydroxypiperidine-1-carbothioamide |
| SMILES | OC1(c2ccc(Br)cc2)CCN(C(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H18BrClN2OS/c19-14-3-1-13(2-4-14)18(23)9-11-22(12-10-18)17(24)21-16-7-5-15(20)6-8-16/h1-8,23H,9-12H2,(H,21,24) |
| InChIKey | LNMLQNKWGRZRTR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|