C17H16BrCl2N3S — CID 162659951
N-(4-bromophenyl)-4-(2,3-dichlorophenyl)piperazine-1-carbothioamide (PubChem CID 162659951) has the molecular formula C17H16BrCl2N3S and a molecular weight of 445.21 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(2,3-dichlorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-bromophenyl)-4-(2,3-dichlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 162659951 |
| Molecular Formula | C17H16BrCl2N3S |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | N-(4-bromophenyl)-4-(2,3-dichlorophenyl)piperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Br)cc1)N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H16BrCl2N3S/c18-12-4-6-13(7-5-12)21-17(24)23-10-8-22(9-11-23)15-3-1-2-14(19)16(15)20/h1-7H,8-11H2,(H,21,24) |
| InChIKey | VFBJOIVEQSZRJV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|