C19H22ClN3OS — CID 3709597
N-(4-chlorophenyl)-4-(2-ethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3709597) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(2-ethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-4-(2-ethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3709597 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(4-chlorophenyl)-4-(2-ethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | CCOc1ccccc1N1CCN(C(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H22ClN3OS/c1-2-24-18-6-4-3-5-17(18)22-11-13-23(14-12-22)19(25)21-16-9-7-15(20)8-10-16/h3-10H,2,11-14H2,1H3,(H,21,25) |
| InChIKey | YDLQKKNXSHBERY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|