C21H27N3OS — CID 17171495
4-(2,5-dimethylphenyl)-N-(4-ethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 17171495) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N-(4-ethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,5-dimethylphenyl)-N-(4-ethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17171495 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N-(4-ethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCN(c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-4-25-19-9-7-18(8-10-19)22-21(26)24-13-11-23(12-14-24)20-15-16(2)5-6-17(20)3/h5-10,15H,4,11-14H2,1-3H3,(H,22,26) |
| InChIKey | GKBWLCANEPBKNJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|