C24H33N3O2 — CID 3229495
N-(4-butoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetamide (PubChem CID 3229495) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-butoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3229495 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetamide |
| SMILES | CCCCOc1ccc(NC(=O)CN2CCN(c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-4-5-16-29-22-10-8-21(9-11-22)25-24(28)18-26-12-14-27(15-13-26)23-17-19(2)6-7-20(23)3/h6-11,17H,4-5,12-16,18H2,1-3H3,(H,25,28) |
| InChIKey | WTLMFYUDKVYCKD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|