C23H28F3N3O2 — CID 3229501
N-(4-butoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 3229501) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-butoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3229501 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | CCCCOc1ccc(NC(=O)CN2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H28F3N3O2/c1-2-3-15-31-21-9-7-19(8-10-21)27-22(30)17-28-11-13-29(14-12-28)20-6-4-5-18(16-20)23(24,25)26/h4-10,16H,2-3,11-15,17H2,1H3,(H,27,30) |
| InChIKey | XHSRLEQLLBFVII-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|