C15H24N3OS+ — CID 8615655
N-(4-ethoxyphenyl)-4-methyl-1,4-diazepan-4-ium-1-carbothioamide (PubChem CID 8615655) has the molecular formula C15H24N3OS+ and a molecular weight of 294.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-methyl-1,4-diazepan-4-ium-1-carbothioamide.
| Compound Name | N-(4-ethoxyphenyl)-4-methyl-1,4-diazepan-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8615655 |
| Molecular Formula | C15H24N3OS+ |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-methyl-1,4-diazepan-4-ium-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C15H23N3OS/c1-3-19-14-7-5-13(6-8-14)16-15(20)18-10-4-9-17(2)11-12-18/h5-8H,3-4,9-12H2,1-2H3,(H,16,20)/p+1 |
| InChIKey | FUXRZGLCLZYBDI-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|