C19H29N3O2S — CID 43076775
1-[(4-ethoxyphenyl)carbamothioyl]-N-(2-methylpropyl)piperidine-3-carboxamide (PubChem CID 43076775) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)carbamothioyl]-N-(2-methylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-[(4-ethoxyphenyl)carbamothioyl]-N-(2-methylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43076775 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-[(4-ethoxyphenyl)carbamothioyl]-N-(2-methylpropyl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(NC(=S)N2CCCC(C(=O)NCC(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O2S/c1-4-24-17-9-7-16(8-10-17)21-19(25)22-11-5-6-15(13-22)18(23)20-12-14(2)3/h7-10,14-15H,4-6,11-13H2,1-3H3,(H,20,23)(H,21,25) |
| InChIKey | HWVAAWUFXARBDK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|