C22H20BrClN2O2 — CID 39334772
(5-bromo-2-pyrrol-1-ylphenyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone (PubChem CID 39334772) has the molecular formula C22H20BrClN2O2 and a molecular weight of 459.77 g/mol. Its IUPAC name is (5-bromo-2-pyrrol-1-ylphenyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone.
| Compound Name | (5-bromo-2-pyrrol-1-ylphenyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 39334772 |
| Molecular Formula | C22H20BrClN2O2 |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (5-bromo-2-pyrrol-1-ylphenyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1-n1cccc1)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H20BrClN2O2/c23-17-5-8-20(25-11-1-2-12-25)19(15-17)21(27)26-13-9-22(28,10-14-26)16-3-6-18(24)7-4-16/h1-8,11-12,15,28H,9-10,13-14H2 |
| InChIKey | BNCYEBGSVKIECQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |