C25H25F3N2O5 — CID 155070832
(1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(2,3-dihydro-1-benzofuran-5-yl)methyl]piperazine-1-carboxylate (PubChem CID 155070832) has the molecular formula C25H25F3N2O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(2,3-dihydro-1-benzofuran-5-yl)methyl]piperazine-1-carboxylate.
| Compound Name | (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(2,3-dihydro-1-benzofuran-5-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155070832 |
| Molecular Formula | C25H25F3N2O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(2,3-dihydro-1-benzofuran-5-yl)methyl]piperazine-1-carboxylate |
| SMILES | O=CC(OC(=O)N1CCN(C(c2ccc3c(c2)CCO3)c2ccc3c(c2)CCO3)CC1)C(F)(F)F |
| InChI | InChI=1S/C25H25F3N2O5/c26-25(27,28)22(15-31)35-24(32)30-9-7-29(8-10-30)23(18-1-3-20-16(13-18)5-11-33-20)19-2-4-21-17(14-19)6-12-34-21/h1-4,13-15,22-23H,5-12H2 |
| InChIKey | WTTGBGXDLZTYHU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|