C14H16O5 — CID 54458812
ethyl 2-acetyloxy-2-(2,3-dihydro-1-benzofuran-5-yl)acetate (PubChem CID 54458812) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl 2-acetyloxy-2-(2,3-dihydro-1-benzofuran-5-yl)acetate.
| Compound Name | ethyl 2-acetyloxy-2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
|---|---|
| PubChem CID | 54458812 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | ethyl 2-acetyloxy-2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
| SMILES | CCOC(=O)C(OC(C)=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H16O5/c1-3-17-14(16)13(19-9(2)15)11-4-5-12-10(8-11)6-7-18-12/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | XADIZYIOVGAVKD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |