C16H23NO3 — CID 64579498
ethyl 4-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]butanoate (PubChem CID 64579498) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl 4-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]butanoate.
| Compound Name | ethyl 4-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]butanoate |
|---|---|
| PubChem CID | 64579498 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 4-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(C)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H23NO3/c1-3-19-16(18)5-4-9-17-12(2)13-6-7-15-14(11-13)8-10-20-15/h6-7,11-12,17H,3-5,8-10H2,1-2H3 |
| InChIKey | KJOSQDKPKNAGEY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|