C11H12O3 — CID 130690343
2-(2,3-dihydro-1-benzofuran-5-yl)-2-methoxyacetaldehyde (PubChem CID 130690343) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-2-methoxyacetaldehyde.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 130690343 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-2-methoxyacetaldehyde |
| SMILES | COC(C=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H12O3/c1-13-11(7-12)8-2-3-10-9(6-8)4-5-14-10/h2-3,6-7,11H,4-5H2,1H3 |
| InChIKey | BFCAPSKHOSQKMS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|