C18H25ClN2O3 — CID 174537041
ethyl 4-[(1S)-1-(4-chlorophenyl)-3-oxopentyl]piperazine-1-carboxylate (PubChem CID 174537041) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is ethyl 4-[(1S)-1-(4-chlorophenyl)-3-oxopentyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1S)-1-(4-chlorophenyl)-3-oxopentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174537041 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethyl 4-[(1S)-1-(4-chlorophenyl)-3-oxopentyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@@H](CC(=O)CC)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-3-16(22)13-17(14-5-7-15(19)8-6-14)20-9-11-21(12-10-20)18(23)24-4-2/h5-8,17H,3-4,9-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | OSKSRCPXJQPJQU-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |