C11H14F2N2OS — CID 55215053
2-(2,5-difluorophenyl)sulfanyl-3-methylbutanehydrazide (PubChem CID 55215053) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanyl-3-methylbutanehydrazide.
| Compound Name | 2-(2,5-difluorophenyl)sulfanyl-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 55215053 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanyl-3-methylbutanehydrazide |
| SMILES | CC(C)C(Sc1cc(F)ccc1F)C(=O)NN |
| InChI | InChI=1S/C11H14F2N2OS/c1-6(2)10(11(16)15-14)17-9-5-7(12)3-4-8(9)13/h3-6,10H,14H2,1-2H3,(H,15,16) |
| InChIKey | FTJLWOIKKRALOI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|