C13H18N2O4S2 — CID 56822525
N-(ethylcarbamoyl)-2-(4-methylsulfonylphenyl)sulfanylpropanamide (PubChem CID 56822525) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(4-methylsulfonylphenyl)sulfanylpropanamide.
| Compound Name | N-(ethylcarbamoyl)-2-(4-methylsulfonylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 56822525 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(4-methylsulfonylphenyl)sulfanylpropanamide |
| SMILES | CCNC(=O)NC(=O)C(C)Sc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-4-14-13(17)15-12(16)9(2)20-10-5-7-11(8-6-10)21(3,18)19/h5-9H,4H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | YCCHJUYVOHGFBJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |