C13H7Br2ClF3N3O2S — CID 25226526
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4,5-dibromothiophene-2-carbonyl)amino]urea (PubChem CID 25226526) has the molecular formula C13H7Br2ClF3N3O2S and a molecular weight of 521.54 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4,5-dibromothiophene-2-carbonyl)amino]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4,5-dibromothiophene-2-carbonyl)amino]urea |
|---|---|
| PubChem CID | 25226526 |
| Molecular Formula | C13H7Br2ClF3N3O2S |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 518.83 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(4,5-dibromothiophene-2-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1cc(Br)c(Br)s1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7Br2ClF3N3O2S/c14-7-4-9(25-10(7)15)11(23)21-22-12(24)20-5-1-2-8(16)6(3-5)13(17,18)19/h1-4H,(H,21,23)(H2,20,22,24) |
| InChIKey | KKQGIRWNDABAAK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|