C16H19ClF3N3O4 — CID 8859501
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-(carbamoylamino)hexanoate (PubChem CID 8859501) has the molecular formula C16H19ClF3N3O4 and a molecular weight of 409.79 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-(carbamoylamino)hexanoate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8859501 |
| Molecular Formula | C16H19ClF3N3O4 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-(carbamoylamino)hexanoate |
| SMILES | NC(=O)NCCCCCC(=O)OCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19ClF3N3O4/c17-12-6-5-10(8-11(12)16(18,19)20)23-13(24)9-27-14(25)4-2-1-3-7-22-15(21)26/h5-6,8H,1-4,7,9H2,(H,23,24)(H3,21,22,26) |
| InChIKey | XHZSYJUJPIOCEU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|