C17H20ClF3N2O4 — CID 55999875
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-acetamidohexanoate (PubChem CID 55999875) has the molecular formula C17H20ClF3N2O4 and a molecular weight of 408.80 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-acetamidohexanoate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55999875 |
| Molecular Formula | C17H20ClF3N2O4 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20ClF3N2O4/c1-11(24)22-8-4-2-3-5-16(26)27-10-15(25)23-12-6-7-14(18)13(9-12)17(19,20)21/h6-7,9H,2-5,8,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | UHUKTLHXPOUZAB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|