C19H27N3O5 — CID 55734747
[2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 6-acetamidohexanoate (PubChem CID 55734747) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 6-acetamidohexanoate.
| Compound Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55734747 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OCC(=O)NC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H27N3O5/c1-13-8-9-16(11-14(13)2)21-19(26)22-17(24)12-27-18(25)7-5-4-6-10-20-15(3)23/h8-9,11H,4-7,10,12H2,1-3H3,(H,20,23)(H2,21,22,24,26) |
| InChIKey | FQWSARYRLCYHIC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|