C18H26N2O6S — CID 55999064
ethyl 5-[[2-(6-acetamidohexanoyloxy)acetyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 55999064) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is ethyl 5-[[2-(6-acetamidohexanoyloxy)acetyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[2-(6-acetamidohexanoyloxy)acetyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55999064 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 5-[[2-(6-acetamidohexanoyloxy)acetyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)CCCCCNC(C)=O)cc1C |
| InChI | InChI=1S/C18H26N2O6S/c1-4-25-18(24)17-12(2)10-15(27-17)20-14(22)11-26-16(23)8-6-5-7-9-19-13(3)21/h10H,4-9,11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | OMKYDGYBNCZLKH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|