C20H25ClN2O3 — CID 2353626
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 2353626) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2353626 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C1CCC(C(=O)OCC(=O)Nc2cc(Cl)ccc2C#N)CC1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-20(2,3)15-7-4-13(5-8-15)19(25)26-12-18(24)23-17-10-16(21)9-6-14(17)11-22/h6,9-10,13,15H,4-5,7-8,12H2,1-3H3,(H,23,24) |
| InChIKey | DIWHPVAPDYWULB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |