C18H17F4NO2S — CID 100757900
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100757900) has the molecular formula C18H17F4NO2S and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100757900 |
| Molecular Formula | C18H17F4NO2S |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCCSCc1ccccc1F |
| InChI | InChI=1S/C18H17F4NO2S/c19-16-7-2-1-4-13(16)12-26-9-8-23-17(24)11-25-15-6-3-5-14(10-15)18(20,21)22/h1-7,10H,8-9,11-12H2,(H,23,24) |
| InChIKey | QSPNLVMPPYRELQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|