C22H24FN5O4S — CID 46489475
3-[[[2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 46489475) has the molecular formula C22H24FN5O4S and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-[[[2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[[2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 46489475 |
| Molecular Formula | C22H24FN5O4S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 3-[[[2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1CC(=O)NNC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H24FN5O4S/c1-14-20(15(2)28(26-14)18-10-8-17(23)9-11-18)13-21(29)24-25-22(30)16-6-5-7-19(12-16)33(31,32)27(3)4/h5-12H,13H2,1-4H3,(H,24,29)(H,25,30) |
| InChIKey | WNPVVHLBSVAQQA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|