C19H30N4O2S2 — CID 8788577
1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8788577) has the molecular formula C19H30N4O2S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8788577 |
| Molecular Formula | C19H30N4O2S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | O=C(NNC(=S)NCCCN1CCOCC1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C19H30N4O2S2/c24-18(17-14-15-6-3-1-2-4-7-16(15)27-17)21-22-19(26)20-8-5-9-23-10-12-25-13-11-23/h14H,1-13H2,(H,21,24)(H2,20,22,26) |
| InChIKey | SHBWEGNRCRBMIS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|