C21H24ClN3O4S2 — CID 26872807
N'-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide (PubChem CID 26872807) has the molecular formula C21H24ClN3O4S2 and a molecular weight of 482.03 g/mol. Its IUPAC name is N'-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26872807 |
| Molecular Formula | C21H24ClN3O4S2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N'-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc2c(s1)CCC2)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H24ClN3O4S2/c22-16-9-8-15(13-19(16)31(28,29)25-10-3-1-2-4-11-25)20(26)23-24-21(27)18-12-14-6-5-7-17(14)30-18/h8-9,12-13H,1-7,10-11H2,(H,23,26)(H,24,27) |
| InChIKey | ZHJVWSBKUWEFHZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|