C9H13N3O3S — CID 43473463
4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]butanoic acid (PubChem CID 43473463) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]butanoic acid.
| Compound Name | 4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43473463 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H13N3O3S/c13-7(12-9-11-4-5-16-9)6-10-3-1-2-8(14)15/h4-5,10H,1-3,6H2,(H,14,15)(H,11,12,13) |
| InChIKey | CYRMZNZJIGSVAG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|