C12H15N3O3S — CID 43468420
2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-3-methylbutanoic acid (PubChem CID 43468420) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43468420 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NCC(=O)Nc1sccc1C#N)C(=O)O |
| InChI | InChI=1S/C12H15N3O3S/c1-7(2)10(12(17)18)14-6-9(16)15-11-8(5-13)3-4-19-11/h3-4,7,10,14H,6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | NUNPKHPJJWWUMT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |