C15H14BrN3OS — CID 25481993
2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-N-(3-cyanothiophen-2-yl)acetamide (PubChem CID 25481993) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-N-(3-cyanothiophen-2-yl)acetamide.
| Compound Name | 2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-N-(3-cyanothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 25481993 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-N-(3-cyanothiophen-2-yl)acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1sccc1C#N)c1ccccc1Br |
| InChI | InChI=1S/C15H14BrN3OS/c1-10(12-4-2-3-5-13(12)16)18-9-14(20)19-15-11(8-17)6-7-21-15/h2-7,10,18H,9H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | RHVTYGYYOOPVTA-SNVBAGLBSA-N |
| XLogP | 3.67 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |