C9H9N3O3S — CID 43466026
2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]acetic acid (PubChem CID 43466026) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 43466026 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]acetic acid |
| SMILES | N#Cc1ccsc1NC(=O)CNCC(=O)O |
| InChI | InChI=1S/C9H9N3O3S/c10-3-6-1-2-16-9(6)12-7(13)4-11-5-8(14)15/h1-2,11H,4-5H2,(H,12,13)(H,14,15) |
| InChIKey | QBVWTLRLJJNMDR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |