C12H11N3O3S — CID 79274861
2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid (PubChem CID 79274861) has the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79274861 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)CC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C12H11N3O3S/c1-2-4-15(8-11(17)18)7-10(16)14-12-9(6-13)3-5-19-12/h1,3,5H,4,7-8H2,(H,14,16)(H,17,18) |
| InChIKey | DHIATZRLVDLIQP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|