C16H17ClN3OS+ — CID 9040917
(4-chlorophenyl)methyl-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]-methylazanium (PubChem CID 9040917) has the molecular formula C16H17ClN3OS+ and a molecular weight of 334.85 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]-methylazanium.
| Compound Name | (4-chlorophenyl)methyl-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]-methylazanium |
|---|---|
| PubChem CID | 9040917 |
| Molecular Formula | C16H17ClN3OS+ |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (4-chlorophenyl)methyl-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]-methylazanium |
| SMILES | C[NH+](CCC(=O)Nc1sccc1C#N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-20(11-12-2-4-14(17)5-3-12)8-6-15(21)19-16-13(10-18)7-9-22-16/h2-5,7,9H,6,8,11H2,1H3,(H,19,21)/p+1 |
| InChIKey | COXJNOJBGOJMPZ-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |